2-(dimethylamino)-2-(2-methoxy-4,6-dimethylphenyl)acetic acid

C13H19NO3 — CID 82476708

IUPAC2-(dimethylamino)-2-(2-methoxy-4,6-dimethylphenyl)acetic acid
SMILESCOc1cc(C)cc(C)c1C(C(=O)O)N(C)C
InChIInChI=1S/C13H19NO3/c1-8-6-9(2)11(10(7-8)17-5)12(13(15)16)14(3)4/h6-7,12H,1-5H3,(H,15,16)
InChIKeyGKLCNCFOKFUIEW-UHFFFAOYSA-N
MW237.30 g/mol
LogP2.00
Rot. Bonds4

About 2-(dimethylamino)-2-(2-methoxy-4,6-dimethylphenyl)acetic acid

2-(dimethylamino)-2-(2-methoxy-4,6-dimethylphenyl)acetic acid (PubChem CID 82476708) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-(dimethylamino)-2-(2-methoxy-4,6-dimethylphenyl)acetic acid.

Molecular Properties

Compound Name2-(dimethylamino)-2-(2-methoxy-4,6-dimethylphenyl)acetic acid
PubChem CID82476708
Molecular FormulaC13H19NO3
Molecular Weight237.30 g/mol
Exact Mass237.14
IUPAC Name2-(dimethylamino)-2-(2-methoxy-4,6-dimethylphenyl)acetic acid
SMILESCOc1cc(C)cc(C)c1C(C(=O)O)N(C)C
InChIInChI=1S/C13H19NO3/c1-8-6-9(2)11(10(7-8)17-5)12(13(15)16)14(3)4/h6-7,12H,1-5H3,(H,15,16)
InChIKeyGKLCNCFOKFUIEW-UHFFFAOYSA-N
XLogP2.00
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.30
LogP ≤ 52.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(dimethylamino)-2-(2-methoxy-4,6-dimethylphenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(dimethylamino)-2-(2-methoxy-4,6-dimethylphenyl)acetic acid?
The IUPAC name of 2-(dimethylamino)-2-(2-methoxy-4,6-dimethylphenyl)acetic acid (CID 82476708) is 2-(dimethylamino)-2-(2-methoxy-4,6-dimethylphenyl)acetic acid.
What is the SMILES notation for 2-(dimethylamino)-2-(2-methoxy-4,6-dimethylphenyl)acetic acid?
The canonical SMILES for 2-(dimethylamino)-2-(2-methoxy-4,6-dimethylphenyl)acetic acid is COc1cc(C)cc(C)c1C(C(=O)O)N(C)C.
What is the InChIKey of 2-(dimethylamino)-2-(2-methoxy-4,6-dimethylphenyl)acetic acid?
The InChIKey is GKLCNCFOKFUIEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO3/c1-8-6-9(2)11(10(7-8)17-5)12(13(15)16)14(3)4/h6-7,12H,1-5H3,(H,15,16).
What are the key properties of 2-(dimethylamino)-2-(2-methoxy-4,6-dimethylphenyl)acetic acid?
2-(dimethylamino)-2-(2-methoxy-4,6-dimethylphenyl)acetic acid has a molecular weight of 237.30 g/mol, XLogP of 2.00, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-2-(2-methoxy-4,6-dimethylphenyl)acetic acid is sourced from PubChem (CID 82476708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).