C16H24O2S — CID 106682608
1-(2-methoxy-4,6-dimethylphenyl)-2-(thian-4-yl)ethanol (PubChem CID 106682608) has the molecular formula C16H24O2S and a molecular weight of 280.43 g/mol. Its IUPAC name is 1-(2-methoxy-4,6-dimethylphenyl)-2-(thian-4-yl)ethanol.
| Compound Name | 1-(2-methoxy-4,6-dimethylphenyl)-2-(thian-4-yl)ethanol |
|---|---|
| PubChem CID | 106682608 |
| Molecular Formula | C16H24O2S |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 1-(2-methoxy-4,6-dimethylphenyl)-2-(thian-4-yl)ethanol |
| SMILES | COc1cc(C)cc(C)c1C(O)CC1CCSCC1 |
| InChI | InChI=1S/C16H24O2S/c1-11-8-12(2)16(15(9-11)18-3)14(17)10-13-4-6-19-7-5-13/h8-9,13-14,17H,4-7,10H2,1-3H3 |
| InChIKey | HZSDHTUNLMDCOK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |