C11H14ClNO4 — CID 106683406
(2S)-2-[(2-chlorofuran-3-carbonyl)amino]-3-methylpentanoic acid (PubChem CID 106683406) has the molecular formula C11H14ClNO4 and a molecular weight of 259.69 g/mol. Its IUPAC name is (2S)-2-[(2-chlorofuran-3-carbonyl)amino]-3-methylpentanoic acid.
| Compound Name | (2S)-2-[(2-chlorofuran-3-carbonyl)amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 106683406 |
| Molecular Formula | C11H14ClNO4 |
| Molecular Weight | 259.69 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | (2S)-2-[(2-chlorofuran-3-carbonyl)amino]-3-methylpentanoic acid |
| SMILES | CCC(C)[C@H](NC(=O)c1ccoc1Cl)C(=O)O |
| InChI | InChI=1S/C11H14ClNO4/c1-3-6(2)8(11(15)16)13-10(14)7-4-5-17-9(7)12/h4-6,8H,3H2,1-2H3,(H,13,14)(H,15,16)/t6?,8-/m0/s1 |
| InChIKey | YFXPGCLJWLMIGM-XDKWHASVSA-N |
| XLogP | 2.16 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.69 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |