C8H10ClNO3 — CID 106688386
2-chloro-N-[(2S)-1-hydroxypropan-2-yl]furan-3-carboxamide (PubChem CID 106688386) has the molecular formula C8H10ClNO3 and a molecular weight of 203.62 g/mol. Its IUPAC name is 2-chloro-N-[(2S)-1-hydroxypropan-2-yl]furan-3-carboxamide.
| Compound Name | 2-chloro-N-[(2S)-1-hydroxypropan-2-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 106688386 |
| Molecular Formula | C8H10ClNO3 |
| Molecular Weight | 203.62 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 2-chloro-N-[(2S)-1-hydroxypropan-2-yl]furan-3-carboxamide |
| SMILES | C[C@@H](CO)NC(=O)c1ccoc1Cl |
| InChI | InChI=1S/C8H10ClNO3/c1-5(4-11)10-8(12)6-2-3-13-7(6)9/h2-3,5,11H,4H2,1H3,(H,10,12)/t5-/m0/s1 |
| InChIKey | NRNQHAJSMLABDT-YFKPBYRVSA-N |
| XLogP | 1.04 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.62 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |