C9H8ClNO4 — CID 106683486
1-(2-chlorofuran-3-carbonyl)azetidine-3-carboxylic acid (PubChem CID 106683486) has the molecular formula C9H8ClNO4 and a molecular weight of 229.62 g/mol. Its IUPAC name is 1-(2-chlorofuran-3-carbonyl)azetidine-3-carboxylic acid.
| Compound Name | 1-(2-chlorofuran-3-carbonyl)azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 106683486 |
| Molecular Formula | C9H8ClNO4 |
| Molecular Weight | 229.62 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | 1-(2-chlorofuran-3-carbonyl)azetidine-3-carboxylic acid |
| SMILES | O=C(O)C1CN(C(=O)c2ccoc2Cl)C1 |
| InChI | InChI=1S/C9H8ClNO4/c10-7-6(1-2-15-7)8(12)11-3-5(4-11)9(13)14/h1-2,5H,3-4H2,(H,13,14) |
| InChIKey | RKEKUCPTMVOYEY-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.62 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |