C12H17ClN2O2 — CID 106687066
(2-chlorofuran-3-yl)-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]methanone (PubChem CID 106687066) has the molecular formula C12H17ClN2O2 and a molecular weight of 256.73 g/mol. Its IUPAC name is (2-chlorofuran-3-yl)-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]methanone.
| Compound Name | (2-chlorofuran-3-yl)-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 106687066 |
| Molecular Formula | C12H17ClN2O2 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | (2-chlorofuran-3-yl)-[3-(dimethylamino)-4-methylpyrrolidin-1-yl]methanone |
| SMILES | CC1CN(C(=O)c2ccoc2Cl)CC1N(C)C |
| InChI | InChI=1S/C12H17ClN2O2/c1-8-6-15(7-10(8)14(2)3)12(16)9-4-5-17-11(9)13/h4-5,8,10H,6-7H2,1-3H3 |
| InChIKey | UVKZVZWSXDVZKD-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |