About [3-[N-amino-N'-(4-iodophenyl)carbamimidoyl]phenyl] acetate
[3-[N-amino-N'-(4-iodophenyl)carbamimidoyl]phenyl] acetate (PubChem CID 10668378) has the molecular formula C15H14IN3O2
and a molecular weight of 395.20 g/mol. Its IUPAC name is [3-[N-amino-N'-(4-iodophenyl)carbamimidoyl]phenyl] acetate.
Molecular Properties
| Compound Name | [3-[N-amino-N'-(4-iodophenyl)carbamimidoyl]phenyl] acetate |
| PubChem CID | 10668378 |
| Molecular Formula | C15H14IN3O2 |
| Molecular Weight | 395.20 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | [3-[N-amino-N'-(4-iodophenyl)carbamimidoyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(/C(=N/c2ccc(I)cc2)NN)c1 |
| InChI | InChI=1S/C15H14IN3O2/c1-10(20)21-14-4-2-3-11(9-14)15(19-17)18-13-7-5-12(16)6-8-13/h2-9H,17H2,1H3,(H,18,19) |
| InChIKey | RKHMUCHMSVVDOS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.20 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-[N-amino-N'-(4-iodophenyl)carbamimidoyl]phenyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[N-amino-N'-(4-iodophenyl)carbamimidoyl]phenyl] acetate?
The IUPAC name of [3-[N-amino-N'-(4-iodophenyl)carbamimidoyl]phenyl] acetate (CID 10668378) is [3-[N-amino-N'-(4-iodophenyl)carbamimidoyl]phenyl] acetate.
What is the SMILES notation for [3-[N-amino-N'-(4-iodophenyl)carbamimidoyl]phenyl] acetate?
The canonical SMILES for [3-[N-amino-N'-(4-iodophenyl)carbamimidoyl]phenyl] acetate is CC(=O)Oc1cccc(/C(=N/c2ccc(I)cc2)NN)c1.
What is the InChIKey of [3-[N-amino-N'-(4-iodophenyl)carbamimidoyl]phenyl] acetate?
The InChIKey is RKHMUCHMSVVDOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14IN3O2/c1-10(20)21-14-4-2-3-11(9-14)15(19-17)18-13-7-5-12(16)6-8-13/h2-9H,17H2,1H3,(H,18,19).
What are the key properties of [3-[N-amino-N'-(4-iodophenyl)carbamimidoyl]phenyl] acetate?
[3-[N-amino-N'-(4-iodophenyl)carbamimidoyl]phenyl] acetate has a molecular weight of 395.20 g/mol, XLogP of 2.76, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[N-amino-N'-(4-iodophenyl)carbamimidoyl]phenyl] acetate is sourced from PubChem (CID 10668378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).