C11H12ClN3O — CID 106688164
3-(2-chlorofuran-3-yl)-5-cyclopentyl-1H-1,2,4-triazole (PubChem CID 106688164) has the molecular formula C11H12ClN3O and a molecular weight of 237.69 g/mol. Its IUPAC name is 3-(2-chlorofuran-3-yl)-5-cyclopentyl-1H-1,2,4-triazole.
| Compound Name | 3-(2-chlorofuran-3-yl)-5-cyclopentyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 106688164 |
| Molecular Formula | C11H12ClN3O |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 3-(2-chlorofuran-3-yl)-5-cyclopentyl-1H-1,2,4-triazole |
| SMILES | Clc1occc1-c1n[nH]c(C2CCCC2)n1 |
| InChI | InChI=1S/C11H12ClN3O/c12-9-8(5-6-16-9)11-13-10(14-15-11)7-3-1-2-4-7/h5-7H,1-4H2,(H,13,14,15) |
| InChIKey | AMMZWIZNBNGFLV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |