C16H16N4 — CID 62876053
8-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)quinoline (PubChem CID 62876053) has the molecular formula C16H16N4 and a molecular weight of 264.33 g/mol. Its IUPAC name is 8-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)quinoline.
| Compound Name | 8-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)quinoline |
|---|---|
| PubChem CID | 62876053 |
| Molecular Formula | C16H16N4 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 8-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)quinoline |
| SMILES | c1cnc2c(-c3n[nH]c(C4CCCC4)n3)cccc2c1 |
| InChI | InChI=1S/C16H16N4/c1-2-6-12(5-1)15-18-16(20-19-15)13-9-3-7-11-8-4-10-17-14(11)13/h3-4,7-10,12H,1-2,5-6H2,(H,18,19,20) |
| InChIKey | NAODFHQEKFLPPP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |