About 5-(5-chlorofuran-2-yl)-1,2,4-oxadiazole-3-carboxylic acid
5-(5-chlorofuran-2-yl)-1,2,4-oxadiazole-3-carboxylic acid (PubChem CID 106689515) has the molecular formula C7H3ClN2O4
and a molecular weight of 214.56 g/mol. Its IUPAC name is 5-(5-chlorofuran-2-yl)-1,2,4-oxadiazole-3-carboxylic acid.
Analyze 5-(5-chlorofuran-2-yl)-1,2,4-oxadiazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-chlorofuran-2-yl)-1,2,4-oxadiazole-3-carboxylic acid?
The IUPAC name of 5-(5-chlorofuran-2-yl)-1,2,4-oxadiazole-3-carboxylic acid (CID 106689515) is 5-(5-chlorofuran-2-yl)-1,2,4-oxadiazole-3-carboxylic acid.
What is the SMILES notation for 5-(5-chlorofuran-2-yl)-1,2,4-oxadiazole-3-carboxylic acid?
The canonical SMILES for 5-(5-chlorofuran-2-yl)-1,2,4-oxadiazole-3-carboxylic acid is O=C(O)c1noc(-c2ccc(Cl)o2)n1.
What is the InChIKey of 5-(5-chlorofuran-2-yl)-1,2,4-oxadiazole-3-carboxylic acid?
The InChIKey is CBBSHVSISYWZNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3ClN2O4/c8-4-2-1-3(13-4)6-9-5(7(11)12)10-14-6/h1-2H,(H,11,12).
What are the key properties of 5-(5-chlorofuran-2-yl)-1,2,4-oxadiazole-3-carboxylic acid?
5-(5-chlorofuran-2-yl)-1,2,4-oxadiazole-3-carboxylic acid has a molecular weight of 214.56 g/mol, XLogP of 1.68, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-chlorofuran-2-yl)-1,2,4-oxadiazole-3-carboxylic acid is sourced from PubChem (CID 106689515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).