C21H31N3O5 — CID 10669017
tert-butyl N-[(1S)-2-[4-[2-(3-methyl-2-oxoimidazolidin-1-yl)ethoxy]phenyl]-1-[(2S)-oxiran-2-yl]ethyl]carbamate (PubChem CID 10669017) has the molecular formula C21H31N3O5 and a molecular weight of 405.50 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-[4-[2-(3-methyl-2-oxoimidazolidin-1-yl)ethoxy]phenyl]-1-[(2S)-oxiran-2-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-[4-[2-(3-methyl-2-oxoimidazolidin-1-yl)ethoxy]phenyl]-1-[(2S)-oxiran-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 10669017 |
| Molecular Formula | C21H31N3O5 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | tert-butyl N-[(1S)-2-[4-[2-(3-methyl-2-oxoimidazolidin-1-yl)ethoxy]phenyl]-1-[(2S)-oxiran-2-yl]ethyl]carbamate |
| SMILES | CN1CCN(CCOc2ccc(C[C@H](NC(=O)OC(C)(C)C)[C@H]3CO3)cc2)C1=O |
| InChI | InChI=1S/C21H31N3O5/c1-21(2,3)29-19(25)22-17(18-14-28-18)13-15-5-7-16(8-6-15)27-12-11-24-10-9-23(4)20(24)26/h5-8,17-18H,9-14H2,1-4H3,(H,22,25)/t17-,18+/m0/s1 |
| InChIKey | INFNUJKNBUZPEO-ZWKOTPCHSA-N |
| XLogP | 2.27 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|