C11H13Cl2NO3 — CID 106690235
(5-chlorofuran-2-yl)-[2-(chloromethyl)-6-methylmorpholin-4-yl]methanone (PubChem CID 106690235) has the molecular formula C11H13Cl2NO3 and a molecular weight of 278.13 g/mol. Its IUPAC name is (5-chlorofuran-2-yl)-[2-(chloromethyl)-6-methylmorpholin-4-yl]methanone.
| Compound Name | (5-chlorofuran-2-yl)-[2-(chloromethyl)-6-methylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 106690235 |
| Molecular Formula | C11H13Cl2NO3 |
| Molecular Weight | 278.13 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | (5-chlorofuran-2-yl)-[2-(chloromethyl)-6-methylmorpholin-4-yl]methanone |
| SMILES | CC1CN(C(=O)c2ccc(Cl)o2)CC(CCl)O1 |
| InChI | InChI=1S/C11H13Cl2NO3/c1-7-5-14(6-8(4-12)16-7)11(15)9-2-3-10(13)17-9/h2-3,7-8H,4-6H2,1H3 |
| InChIKey | QDQHLIDSPXFUIO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.13 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|