C15H18ClNO4 — CID 102937454
[2-(chloromethyl)-6-methylmorpholin-4-yl]-(2,3-dihydro-1,4-benzodioxin-6-yl)methanone (PubChem CID 102937454) has the molecular formula C15H18ClNO4 and a molecular weight of 311.77 g/mol. Its IUPAC name is [2-(chloromethyl)-6-methylmorpholin-4-yl]-(2,3-dihydro-1,4-benzodioxin-6-yl)methanone.
| Compound Name | [2-(chloromethyl)-6-methylmorpholin-4-yl]-(2,3-dihydro-1,4-benzodioxin-6-yl)methanone |
|---|---|
| PubChem CID | 102937454 |
| Molecular Formula | C15H18ClNO4 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | [2-(chloromethyl)-6-methylmorpholin-4-yl]-(2,3-dihydro-1,4-benzodioxin-6-yl)methanone |
| SMILES | CC1CN(C(=O)c2ccc3c(c2)OCCO3)CC(CCl)O1 |
| InChI | InChI=1S/C15H18ClNO4/c1-10-8-17(9-12(7-16)21-10)15(18)11-2-3-13-14(6-11)20-5-4-19-13/h2-3,6,10,12H,4-5,7-9H2,1H3 |
| InChIKey | KMEPRPGUSKMAAC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|