C20H21NO4 — CID 110644171
1,3-benzodioxol-5-yl-(2-benzyl-6-methylmorpholin-4-yl)methanone (PubChem CID 110644171) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-(2-benzyl-6-methylmorpholin-4-yl)methanone.
| Compound Name | 1,3-benzodioxol-5-yl-(2-benzyl-6-methylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 110644171 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 1,3-benzodioxol-5-yl-(2-benzyl-6-methylmorpholin-4-yl)methanone |
| SMILES | CC1CN(C(=O)c2ccc3c(c2)OCO3)CC(Cc2ccccc2)O1 |
| InChI | InChI=1S/C20H21NO4/c1-14-11-21(12-17(25-14)9-15-5-3-2-4-6-15)20(22)16-7-8-18-19(10-16)24-13-23-18/h2-8,10,14,17H,9,11-13H2,1H3 |
| InChIKey | UTMGGECUWWGUEF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |