C13H11ClO4 — CID 106690992
(5-chlorofuran-2-yl)-(2,4-dimethoxyphenyl)methanone (PubChem CID 106690992) has the molecular formula C13H11ClO4 and a molecular weight of 266.68 g/mol. Its IUPAC name is (5-chlorofuran-2-yl)-(2,4-dimethoxyphenyl)methanone.
| Compound Name | (5-chlorofuran-2-yl)-(2,4-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 106690992 |
| Molecular Formula | C13H11ClO4 |
| Molecular Weight | 266.68 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | (5-chlorofuran-2-yl)-(2,4-dimethoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2ccc(Cl)o2)c(OC)c1 |
| InChI | InChI=1S/C13H11ClO4/c1-16-8-3-4-9(11(7-8)17-2)13(15)10-5-6-12(14)18-10/h3-7H,1-2H3 |
| InChIKey | WNGODNNVGKDDHO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.68 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |