C15H24ClNO3S — CID 106692659
N-[(5-chlorofuran-2-yl)-(3-methylsulfonylcyclohexyl)methyl]propan-1-amine (PubChem CID 106692659) has the molecular formula C15H24ClNO3S and a molecular weight of 333.88 g/mol. Its IUPAC name is N-[(5-chlorofuran-2-yl)-(3-methylsulfonylcyclohexyl)methyl]propan-1-amine.
| Compound Name | N-[(5-chlorofuran-2-yl)-(3-methylsulfonylcyclohexyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 106692659 |
| Molecular Formula | C15H24ClNO3S |
| Molecular Weight | 333.88 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | N-[(5-chlorofuran-2-yl)-(3-methylsulfonylcyclohexyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(Cl)o1)C1CCCC(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C15H24ClNO3S/c1-3-9-17-15(13-7-8-14(16)20-13)11-5-4-6-12(10-11)21(2,18)19/h7-8,11-12,15,17H,3-6,9-10H2,1-2H3 |
| InChIKey | NPEWUQKQVILILH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.88 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |