C12H10Cl2FNO — CID 106693400
1-(2-chloro-5-fluorophenyl)-1-(2-chlorofuran-3-yl)-N-methylmethanamine (PubChem CID 106693400) has the molecular formula C12H10Cl2FNO and a molecular weight of 274.12 g/mol. Its IUPAC name is 1-(2-chloro-5-fluorophenyl)-1-(2-chlorofuran-3-yl)-N-methylmethanamine.
| Compound Name | 1-(2-chloro-5-fluorophenyl)-1-(2-chlorofuran-3-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 106693400 |
| Molecular Formula | C12H10Cl2FNO |
| Molecular Weight | 274.12 g/mol |
| Exact Mass | 273.01 |
| IUPAC Name | 1-(2-chloro-5-fluorophenyl)-1-(2-chlorofuran-3-yl)-N-methylmethanamine |
| SMILES | CNC(c1cc(F)ccc1Cl)c1ccoc1Cl |
| InChI | InChI=1S/C12H10Cl2FNO/c1-16-11(8-4-5-17-12(8)14)9-6-7(15)2-3-10(9)13/h2-6,11,16H,1H3 |
| InChIKey | AZQPJIWMWONYTL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.12 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |