C13H13Cl2NO — CID 107561912
1-(2-chlorofuran-3-yl)-1-(3-chloro-4-methylphenyl)-N-methylmethanamine (PubChem CID 107561912) has the molecular formula C13H13Cl2NO and a molecular weight of 270.16 g/mol. Its IUPAC name is 1-(2-chlorofuran-3-yl)-1-(3-chloro-4-methylphenyl)-N-methylmethanamine.
| Compound Name | 1-(2-chlorofuran-3-yl)-1-(3-chloro-4-methylphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 107561912 |
| Molecular Formula | C13H13Cl2NO |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 1-(2-chlorofuran-3-yl)-1-(3-chloro-4-methylphenyl)-N-methylmethanamine |
| SMILES | CNC(c1ccc(C)c(Cl)c1)c1ccoc1Cl |
| InChI | InChI=1S/C13H13Cl2NO/c1-8-3-4-9(7-11(8)14)12(16-2)10-5-6-17-13(10)15/h3-7,12,16H,1-2H3 |
| InChIKey | OTFVOKVDDJSDNX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |