C11H12ClNOS — CID 106692255
1-(2-chlorofuran-3-yl)-N-methyl-1-(5-methylthiophen-3-yl)methanamine (PubChem CID 106692255) has the molecular formula C11H12ClNOS and a molecular weight of 241.74 g/mol. Its IUPAC name is 1-(2-chlorofuran-3-yl)-N-methyl-1-(5-methylthiophen-3-yl)methanamine.
| Compound Name | 1-(2-chlorofuran-3-yl)-N-methyl-1-(5-methylthiophen-3-yl)methanamine |
|---|---|
| PubChem CID | 106692255 |
| Molecular Formula | C11H12ClNOS |
| Molecular Weight | 241.74 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | 1-(2-chlorofuran-3-yl)-N-methyl-1-(5-methylthiophen-3-yl)methanamine |
| SMILES | CNC(c1csc(C)c1)c1ccoc1Cl |
| InChI | InChI=1S/C11H12ClNOS/c1-7-5-8(6-15-7)10(13-2)9-3-4-14-11(9)12/h3-6,10,13H,1-2H3 |
| InChIKey | WHQXTZXKUYMQMT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.74 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |