C13H12ClF2NS — CID 104991309
1-(4-chloro-2,5-difluorophenyl)-N-methyl-1-(5-methylthiophen-3-yl)methanamine (PubChem CID 104991309) has the molecular formula C13H12ClF2NS and a molecular weight of 287.76 g/mol. Its IUPAC name is 1-(4-chloro-2,5-difluorophenyl)-N-methyl-1-(5-methylthiophen-3-yl)methanamine.
| Compound Name | 1-(4-chloro-2,5-difluorophenyl)-N-methyl-1-(5-methylthiophen-3-yl)methanamine |
|---|---|
| PubChem CID | 104991309 |
| Molecular Formula | C13H12ClF2NS |
| Molecular Weight | 287.76 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 1-(4-chloro-2,5-difluorophenyl)-N-methyl-1-(5-methylthiophen-3-yl)methanamine |
| SMILES | CNC(c1csc(C)c1)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C13H12ClF2NS/c1-7-3-8(6-18-7)13(17-2)9-4-12(16)10(14)5-11(9)15/h3-6,13,17H,1-2H3 |
| InChIKey | BBOAYTPMWGYUDY-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.76 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|