C13H11BrClF2NS — CID 82782544
1-(3-bromo-5-methylthiophen-2-yl)-1-(4-chloro-2,5-difluorophenyl)-N-methylmethanamine (PubChem CID 82782544) has the molecular formula C13H11BrClF2NS and a molecular weight of 366.66 g/mol. Its IUPAC name is 1-(3-bromo-5-methylthiophen-2-yl)-1-(4-chloro-2,5-difluorophenyl)-N-methylmethanamine.
| Compound Name | 1-(3-bromo-5-methylthiophen-2-yl)-1-(4-chloro-2,5-difluorophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 82782544 |
| Molecular Formula | C13H11BrClF2NS |
| Molecular Weight | 366.66 g/mol |
| Exact Mass | 364.95 |
| IUPAC Name | 1-(3-bromo-5-methylthiophen-2-yl)-1-(4-chloro-2,5-difluorophenyl)-N-methylmethanamine |
| SMILES | CNC(c1cc(F)c(Cl)cc1F)c1sc(C)cc1Br |
| InChI | InChI=1S/C13H11BrClF2NS/c1-6-3-8(14)13(19-6)12(18-2)7-4-11(17)9(15)5-10(7)16/h3-5,12,18H,1-2H3 |
| InChIKey | ZOVHMYJJSVONKX-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.66 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|