C14H15BrClF2N3 — CID 105042139
1-(4-bromo-1-propan-2-ylpyrazol-5-yl)-1-(4-chloro-2,5-difluorophenyl)-N-methylmethanamine (PubChem CID 105042139) has the molecular formula C14H15BrClF2N3 and a molecular weight of 378.65 g/mol. Its IUPAC name is 1-(4-bromo-1-propan-2-ylpyrazol-5-yl)-1-(4-chloro-2,5-difluorophenyl)-N-methylmethanamine.
| Compound Name | 1-(4-bromo-1-propan-2-ylpyrazol-5-yl)-1-(4-chloro-2,5-difluorophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 105042139 |
| Molecular Formula | C14H15BrClF2N3 |
| Molecular Weight | 378.65 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | 1-(4-bromo-1-propan-2-ylpyrazol-5-yl)-1-(4-chloro-2,5-difluorophenyl)-N-methylmethanamine |
| SMILES | CNC(c1cc(F)c(Cl)cc1F)c1c(Br)cnn1C(C)C |
| InChI | InChI=1S/C14H15BrClF2N3/c1-7(2)21-14(9(15)6-20-21)13(19-3)8-4-12(18)10(16)5-11(8)17/h4-7,13,19H,1-3H3 |
| InChIKey | QLXZJZFKASESGL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.65 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|