C12H10ClF2NO — CID 82783225
1-(4-chloro-2,5-difluorophenyl)-1-(furan-2-yl)-N-methylmethanamine (PubChem CID 82783225) has the molecular formula C12H10ClF2NO and a molecular weight of 257.67 g/mol. Its IUPAC name is 1-(4-chloro-2,5-difluorophenyl)-1-(furan-2-yl)-N-methylmethanamine.
| Compound Name | 1-(4-chloro-2,5-difluorophenyl)-1-(furan-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 82783225 |
| Molecular Formula | C12H10ClF2NO |
| Molecular Weight | 257.67 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 1-(4-chloro-2,5-difluorophenyl)-1-(furan-2-yl)-N-methylmethanamine |
| SMILES | CNC(c1ccco1)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C12H10ClF2NO/c1-16-12(11-3-2-4-17-11)7-5-10(15)8(13)6-9(7)14/h2-6,12,16H,1H3 |
| InChIKey | QTDKJXBOXJKWDB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.67 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|