C21H24O4Se — CID 10669738
(2R,3aR,7S,7aS)-7,7a-dimethyl-4'-(phenylseleninylmethyl)spiro[3,3a,4,7-tetrahydroindene-2,3'-oxolane]-1,2'-dione (PubChem CID 10669738) has the molecular formula C21H24O4Se and a molecular weight of 419.38 g/mol. Its IUPAC name is (2R,3aR,7S,7aS)-7,7a-dimethyl-4'-(phenylseleninylmethyl)spiro[3,3a,4,7-tetrahydroindene-2,3'-oxolane]-1,2'-dione.
| Compound Name | (2R,3aR,7S,7aS)-7,7a-dimethyl-4'-(phenylseleninylmethyl)spiro[3,3a,4,7-tetrahydroindene-2,3'-oxolane]-1,2'-dione |
|---|---|
| PubChem CID | 10669738 |
| Molecular Formula | C21H24O4Se |
| Molecular Weight | 419.38 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | (2R,3aR,7S,7aS)-7,7a-dimethyl-4'-(phenylseleninylmethyl)spiro[3,3a,4,7-tetrahydroindene-2,3'-oxolane]-1,2'-dione |
| SMILES | C[C@H]1C=CC[C@@H]2C[C@]3(C(=O)OCC3C[Se](=O)c3ccccc3)C(=O)[C@@]21C |
| InChI | InChI=1S/C21H24O4Se/c1-14-7-6-8-15-11-21(18(22)20(14,15)2)16(12-25-19(21)23)13-26(24)17-9-4-3-5-10-17/h3-7,9-10,14-16H,8,11-13H2,1-2H3/t14-,15+,16?,20+,21+,26?/m0/s1 |
| InChIKey | NVIALDCXBZTSDH-HNFBBNNASA-N |
| XLogP | 2.67 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|