C16H18O5 — CID 10062794
[(2R,3S,4R)-4-acetyl-4-benzyl-3-methyl-5-oxooxolan-2-yl] acetate (PubChem CID 10062794) has the molecular formula C16H18O5 and a molecular weight of 290.31 g/mol. Its IUPAC name is [(2R,3S,4R)-4-acetyl-4-benzyl-3-methyl-5-oxooxolan-2-yl] acetate.
| Compound Name | [(2R,3S,4R)-4-acetyl-4-benzyl-3-methyl-5-oxooxolan-2-yl] acetate |
|---|---|
| PubChem CID | 10062794 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | [(2R,3S,4R)-4-acetyl-4-benzyl-3-methyl-5-oxooxolan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1OC(=O)[C@@](Cc2ccccc2)(C(C)=O)[C@@H]1C |
| InChI | InChI=1S/C16H18O5/c1-10-14(20-12(3)18)21-15(19)16(10,11(2)17)9-13-7-5-4-6-8-13/h4-8,10,14H,9H2,1-3H3/t10-,14-,16-/m1/s1 |
| InChIKey | AJGSHTFHFRJBIL-QSGSBWRWSA-N |
| XLogP | 1.89 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|