5-acetyl-2-(piperidin-1-ylamino)-1,3-thiazole-4-carboxylic acid

C11H15N3O3S — CID 106697979

IUPAC5-acetyl-2-(piperidin-1-ylamino)-1,3-thiazole-4-carboxylic acid
SMILESCC(=O)c1sc(NN2CCCCC2)nc1C(=O)O
InChIInChI=1S/C11H15N3O3S/c1-7(15)9-8(10(16)17)12-11(18-9)13-14-5-3-2-4-6-14/h2-6H2,1H3,(H,12,13)(H,16,17)
InChIKeyALNNOZSAHXDMGH-UHFFFAOYSA-N
MW269.33 g/mol
LogP1.86
Rot. Bonds4

About 5-acetyl-2-(piperidin-1-ylamino)-1,3-thiazole-4-carboxylic acid

5-acetyl-2-(piperidin-1-ylamino)-1,3-thiazole-4-carboxylic acid (PubChem CID 106697979) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is 5-acetyl-2-(piperidin-1-ylamino)-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name5-acetyl-2-(piperidin-1-ylamino)-1,3-thiazole-4-carboxylic acid
PubChem CID106697979
Molecular FormulaC11H15N3O3S
Molecular Weight269.33 g/mol
Exact Mass269.08
IUPAC Name5-acetyl-2-(piperidin-1-ylamino)-1,3-thiazole-4-carboxylic acid
SMILESCC(=O)c1sc(NN2CCCCC2)nc1C(=O)O
InChIInChI=1S/C11H15N3O3S/c1-7(15)9-8(10(16)17)12-11(18-9)13-14-5-3-2-4-6-14/h2-6H2,1H3,(H,12,13)(H,16,17)
InChIKeyALNNOZSAHXDMGH-UHFFFAOYSA-N
XLogP1.86
TPSA82.53 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.33
LogP ≤ 51.86
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze 5-acetyl-2-(piperidin-1-ylamino)-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-acetyl-2-(piperidin-1-ylamino)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-acetyl-2-(piperidin-1-ylamino)-1,3-thiazole-4-carboxylic acid (CID 106697979) is 5-acetyl-2-(piperidin-1-ylamino)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-acetyl-2-(piperidin-1-ylamino)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-acetyl-2-(piperidin-1-ylamino)-1,3-thiazole-4-carboxylic acid is CC(=O)c1sc(NN2CCCCC2)nc1C(=O)O.
What is the InChIKey of 5-acetyl-2-(piperidin-1-ylamino)-1,3-thiazole-4-carboxylic acid?
The InChIKey is ALNNOZSAHXDMGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O3S/c1-7(15)9-8(10(16)17)12-11(18-9)13-14-5-3-2-4-6-14/h2-6H2,1H3,(H,12,13)(H,16,17).
What are the key properties of 5-acetyl-2-(piperidin-1-ylamino)-1,3-thiazole-4-carboxylic acid?
5-acetyl-2-(piperidin-1-ylamino)-1,3-thiazole-4-carboxylic acid has a molecular weight of 269.33 g/mol, XLogP of 1.86, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-2-(piperidin-1-ylamino)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 106697979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).