C11H15N3O3S — CID 106697979
5-acetyl-2-(piperidin-1-ylamino)-1,3-thiazole-4-carboxylic acid (PubChem CID 106697979) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is 5-acetyl-2-(piperidin-1-ylamino)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-acetyl-2-(piperidin-1-ylamino)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 106697979 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 5-acetyl-2-(piperidin-1-ylamino)-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(=O)c1sc(NN2CCCCC2)nc1C(=O)O |
| InChI | InChI=1S/C11H15N3O3S/c1-7(15)9-8(10(16)17)12-11(18-9)13-14-5-3-2-4-6-14/h2-6H2,1H3,(H,12,13)(H,16,17) |
| InChIKey | ALNNOZSAHXDMGH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |