C14H11BrFNO3 — CID 106698935
4-[(5-bromo-3-methyl-2-oxo-1-pyridinyl)methyl]-2-fluorobenzoic acid (PubChem CID 106698935) has the molecular formula C14H11BrFNO3 and a molecular weight of 340.15 g/mol. Its IUPAC name is 4-[(5-bromo-3-methyl-2-oxo-1-pyridinyl)methyl]-2-fluorobenzoic acid.
| Compound Name | 4-[(5-bromo-3-methyl-2-oxo-1-pyridinyl)methyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 106698935 |
| Molecular Formula | C14H11BrFNO3 |
| Molecular Weight | 340.15 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | 4-[(5-bromo-3-methyl-2-oxo-1-pyridinyl)methyl]-2-fluorobenzoic acid |
| SMILES | Cc1cc(Br)cn(Cc2ccc(C(=O)O)c(F)c2)c1=O |
| InChI | InChI=1S/C14H11BrFNO3/c1-8-4-10(15)7-17(13(8)18)6-9-2-3-11(14(19)20)12(16)5-9/h2-5,7H,6H2,1H3,(H,19,20) |
| InChIKey | ZICOEKUFPKIVOK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.15 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |