About 3,3-dipropyl-7-(trifluoromethoxy)-1,2-dihydroindole
3,3-dipropyl-7-(trifluoromethoxy)-1,2-dihydroindole (PubChem CID 106701692) has the molecular formula C15H20F3NO
and a molecular weight of 287.32 g/mol. Its IUPAC name is 3,3-dipropyl-7-(trifluoromethoxy)-1,2-dihydroindole.
Molecular Properties
| Compound Name | 3,3-dipropyl-7-(trifluoromethoxy)-1,2-dihydroindole |
| PubChem CID | 106701692 |
| Molecular Formula | C15H20F3NO |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 3,3-dipropyl-7-(trifluoromethoxy)-1,2-dihydroindole |
| SMILES | CCCC1(CCC)CNc2c(OC(F)(F)F)cccc21 |
| InChI | InChI=1S/C15H20F3NO/c1-3-8-14(9-4-2)10-19-13-11(14)6-5-7-12(13)20-15(16,17)18/h5-7,19H,3-4,8-10H2,1-2H3 |
| InChIKey | GEPXHDGTWAGUDQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-dipropyl-7-(trifluoromethoxy)-1,2-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dipropyl-7-(trifluoromethoxy)-1,2-dihydroindole?
The IUPAC name of 3,3-dipropyl-7-(trifluoromethoxy)-1,2-dihydroindole (CID 106701692) is 3,3-dipropyl-7-(trifluoromethoxy)-1,2-dihydroindole.
What is the SMILES notation for 3,3-dipropyl-7-(trifluoromethoxy)-1,2-dihydroindole?
The canonical SMILES for 3,3-dipropyl-7-(trifluoromethoxy)-1,2-dihydroindole is CCCC1(CCC)CNc2c(OC(F)(F)F)cccc21.
What is the InChIKey of 3,3-dipropyl-7-(trifluoromethoxy)-1,2-dihydroindole?
The InChIKey is GEPXHDGTWAGUDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20F3NO/c1-3-8-14(9-4-2)10-19-13-11(14)6-5-7-12(13)20-15(16,17)18/h5-7,19H,3-4,8-10H2,1-2H3.
What are the key properties of 3,3-dipropyl-7-(trifluoromethoxy)-1,2-dihydroindole?
3,3-dipropyl-7-(trifluoromethoxy)-1,2-dihydroindole has a molecular weight of 287.32 g/mol, XLogP of 4.85, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dipropyl-7-(trifluoromethoxy)-1,2-dihydroindole is sourced from PubChem (CID 106701692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).