C13H14Cl2N2O2 — CID 106702943
5-butan-2-yl-3-(2,5-dichlorophenyl)imidazolidine-2,4-dione (PubChem CID 106702943) has the molecular formula C13H14Cl2N2O2 and a molecular weight of 301.17 g/mol. Its IUPAC name is 5-butan-2-yl-3-(2,5-dichlorophenyl)imidazolidine-2,4-dione.
| Compound Name | 5-butan-2-yl-3-(2,5-dichlorophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 106702943 |
| Molecular Formula | C13H14Cl2N2O2 |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 5-butan-2-yl-3-(2,5-dichlorophenyl)imidazolidine-2,4-dione |
| SMILES | CCC(C)C1NC(=O)N(c2cc(Cl)ccc2Cl)C1=O |
| InChI | InChI=1S/C13H14Cl2N2O2/c1-3-7(2)11-12(18)17(13(19)16-11)10-6-8(14)4-5-9(10)15/h4-7,11H,3H2,1-2H3,(H,16,19) |
| InChIKey | FRVGCIJOKQHWCG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|