C17H13FN2O — CID 106703249
N-(2-cyano-3-fluorophenyl)-2,3-dihydro-1H-indene-2-carboxamide (PubChem CID 106703249) has the molecular formula C17H13FN2O and a molecular weight of 280.30 g/mol. Its IUPAC name is N-(2-cyano-3-fluorophenyl)-2,3-dihydro-1H-indene-2-carboxamide.
| Compound Name | N-(2-cyano-3-fluorophenyl)-2,3-dihydro-1H-indene-2-carboxamide |
|---|---|
| PubChem CID | 106703249 |
| Molecular Formula | C17H13FN2O |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | N-(2-cyano-3-fluorophenyl)-2,3-dihydro-1H-indene-2-carboxamide |
| SMILES | N#Cc1c(F)cccc1NC(=O)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C17H13FN2O/c18-15-6-3-7-16(14(15)10-19)20-17(21)13-8-11-4-1-2-5-12(11)9-13/h1-7,13H,8-9H2,(H,20,21) |
| InChIKey | HYHWKJIPPDXCFW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |