C12H11FN2O2 — CID 61276767
N-(2-cyano-3-fluorophenyl)oxolane-3-carboxamide (PubChem CID 61276767) has the molecular formula C12H11FN2O2 and a molecular weight of 234.23 g/mol. Its IUPAC name is N-(2-cyano-3-fluorophenyl)oxolane-3-carboxamide.
| Compound Name | N-(2-cyano-3-fluorophenyl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 61276767 |
| Molecular Formula | C12H11FN2O2 |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | N-(2-cyano-3-fluorophenyl)oxolane-3-carboxamide |
| SMILES | N#Cc1c(F)cccc1NC(=O)C1CCOC1 |
| InChI | InChI=1S/C12H11FN2O2/c13-10-2-1-3-11(9(10)6-14)15-12(16)8-4-5-17-7-8/h1-3,8H,4-5,7H2,(H,15,16) |
| InChIKey | JDLCYHZZUYNCJC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |