C13H16BrF2NO — CID 106704265
3-[[3-(3-bromophenyl)cyclobutyl]amino]-1,1-difluoropropan-2-ol (PubChem CID 106704265) has the molecular formula C13H16BrF2NO and a molecular weight of 320.18 g/mol. Its IUPAC name is 3-[[3-(3-bromophenyl)cyclobutyl]amino]-1,1-difluoropropan-2-ol.
| Compound Name | 3-[[3-(3-bromophenyl)cyclobutyl]amino]-1,1-difluoropropan-2-ol |
|---|---|
| PubChem CID | 106704265 |
| Molecular Formula | C13H16BrF2NO |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 3-[[3-(3-bromophenyl)cyclobutyl]amino]-1,1-difluoropropan-2-ol |
| SMILES | OC(CNC1CC(c2cccc(Br)c2)C1)C(F)F |
| InChI | InChI=1S/C13H16BrF2NO/c14-10-3-1-2-8(4-10)9-5-11(6-9)17-7-12(18)13(15)16/h1-4,9,11-13,17-18H,5-7H2 |
| InChIKey | DWWPXNIZEQTDGS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |