C13H16BrN — CID 43632521
3-(3-bromophenyl)-N-prop-2-enylcyclobutan-1-amine (PubChem CID 43632521) has the molecular formula C13H16BrN and a molecular weight of 266.18 g/mol. Its IUPAC name is 3-(3-bromophenyl)-N-prop-2-enylcyclobutan-1-amine.
| Compound Name | 3-(3-bromophenyl)-N-prop-2-enylcyclobutan-1-amine |
|---|---|
| PubChem CID | 43632521 |
| Molecular Formula | C13H16BrN |
| Molecular Weight | 266.18 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 3-(3-bromophenyl)-N-prop-2-enylcyclobutan-1-amine |
| SMILES | C=CCNC1CC(c2cccc(Br)c2)C1 |
| InChI | InChI=1S/C13H16BrN/c1-2-6-15-13-8-11(9-13)10-4-3-5-12(14)7-10/h2-5,7,11,13,15H,1,6,8-9H2 |
| InChIKey | PTONRZWGIYCISO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.18 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|