C12H14F3N3O2 — CID 106704854
1-(2-aminophenyl)-3-(2,2,2-trifluoroethoxymethyl)imidazolidin-2-one (PubChem CID 106704854) has the molecular formula C12H14F3N3O2 and a molecular weight of 289.26 g/mol. Its IUPAC name is 1-(2-aminophenyl)-3-(2,2,2-trifluoroethoxymethyl)imidazolidin-2-one.
| Compound Name | 1-(2-aminophenyl)-3-(2,2,2-trifluoroethoxymethyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 106704854 |
| Molecular Formula | C12H14F3N3O2 |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 1-(2-aminophenyl)-3-(2,2,2-trifluoroethoxymethyl)imidazolidin-2-one |
| SMILES | Nc1ccccc1N1CCN(COCC(F)(F)F)C1=O |
| InChI | InChI=1S/C12H14F3N3O2/c13-12(14,15)7-20-8-17-5-6-18(11(17)19)10-4-2-1-3-9(10)16/h1-4H,5-8,16H2 |
| InChIKey | MVGDBFVKYQFJCQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|