C17H25NO3 — CID 106707109
tert-butyl 4-[methyl-[(3-methylphenyl)methyl]amino]-4-oxobutanoate (PubChem CID 106707109) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is tert-butyl 4-[methyl-[(3-methylphenyl)methyl]amino]-4-oxobutanoate.
| Compound Name | tert-butyl 4-[methyl-[(3-methylphenyl)methyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 106707109 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | tert-butyl 4-[methyl-[(3-methylphenyl)methyl]amino]-4-oxobutanoate |
| SMILES | Cc1cccc(CN(C)C(=O)CCC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C17H25NO3/c1-13-7-6-8-14(11-13)12-18(5)15(19)9-10-16(20)21-17(2,3)4/h6-8,11H,9-10,12H2,1-5H3 |
| InChIKey | YCHVKRSVRYCDGB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |