C15H23NO4 — CID 106707019
tert-butyl 4-[methyl-[(5-methylfuran-2-yl)methyl]amino]-4-oxobutanoate (PubChem CID 106707019) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is tert-butyl 4-[methyl-[(5-methylfuran-2-yl)methyl]amino]-4-oxobutanoate.
| Compound Name | tert-butyl 4-[methyl-[(5-methylfuran-2-yl)methyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 106707019 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | tert-butyl 4-[methyl-[(5-methylfuran-2-yl)methyl]amino]-4-oxobutanoate |
| SMILES | Cc1ccc(CN(C)C(=O)CCC(=O)OC(C)(C)C)o1 |
| InChI | InChI=1S/C15H23NO4/c1-11-6-7-12(19-11)10-16(5)13(17)8-9-14(18)20-15(2,3)4/h6-7H,8-10H2,1-5H3 |
| InChIKey | FXJXXESPZCIYKP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |