C18H23NO2 — CID 78794973
3-(4-ethylphenyl)-N-methyl-N-[(5-methylfuran-2-yl)methyl]propanamide (PubChem CID 78794973) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-(4-ethylphenyl)-N-methyl-N-[(5-methylfuran-2-yl)methyl]propanamide.
| Compound Name | 3-(4-ethylphenyl)-N-methyl-N-[(5-methylfuran-2-yl)methyl]propanamide |
|---|---|
| PubChem CID | 78794973 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 3-(4-ethylphenyl)-N-methyl-N-[(5-methylfuran-2-yl)methyl]propanamide |
| SMILES | CCc1ccc(CCC(=O)N(C)Cc2ccc(C)o2)cc1 |
| InChI | InChI=1S/C18H23NO2/c1-4-15-6-8-16(9-7-15)10-12-18(20)19(3)13-17-11-5-14(2)21-17/h5-9,11H,4,10,12-13H2,1-3H3 |
| InChIKey | PCUUGTIBDPHHPS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |