C15H25N3O3 — CID 106707672
tert-butyl 4-[(3-ethyl-1-methylpyrazol-4-yl)methylamino]-4-oxobutanoate (PubChem CID 106707672) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is tert-butyl 4-[(3-ethyl-1-methylpyrazol-4-yl)methylamino]-4-oxobutanoate.
| Compound Name | tert-butyl 4-[(3-ethyl-1-methylpyrazol-4-yl)methylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 106707672 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | tert-butyl 4-[(3-ethyl-1-methylpyrazol-4-yl)methylamino]-4-oxobutanoate |
| SMILES | CCc1nn(C)cc1CNC(=O)CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H25N3O3/c1-6-12-11(10-18(5)17-12)9-16-13(19)7-8-14(20)21-15(2,3)4/h10H,6-9H2,1-5H3,(H,16,19) |
| InChIKey | FEBBTMFJSMEARM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |