C10H19ClN4O — CID 120705685
N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-2-(methylamino)acetamide;hydrochloride (PubChem CID 120705685) has the molecular formula C10H19ClN4O and a molecular weight of 246.74 g/mol. Its IUPAC name is N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-2-(methylamino)acetamide;hydrochloride.
| Compound Name | N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-2-(methylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120705685 |
| Molecular Formula | C10H19ClN4O |
| Molecular Weight | 246.74 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-2-(methylamino)acetamide;hydrochloride |
| SMILES | CCc1nn(C)cc1CNC(=O)CNC.Cl |
| InChI | InChI=1S/C10H18N4O.ClH/c1-4-9-8(7-14(3)13-9)5-12-10(15)6-11-2;/h7,11H,4-6H2,1-3H3,(H,12,15);1H |
| InChIKey | NEGWTLWJVNTBMW-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.74 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |