C13H29N3O — CID 106708016
2-[(6-amino-5,5-dimethylhexyl)-propan-2-ylamino]acetamide (PubChem CID 106708016) has the molecular formula C13H29N3O and a molecular weight of 243.39 g/mol. Its IUPAC name is 2-[(6-amino-5,5-dimethylhexyl)-propan-2-ylamino]acetamide.
| Compound Name | 2-[(6-amino-5,5-dimethylhexyl)-propan-2-ylamino]acetamide |
|---|---|
| PubChem CID | 106708016 |
| Molecular Formula | C13H29N3O |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.23 |
| IUPAC Name | 2-[(6-amino-5,5-dimethylhexyl)-propan-2-ylamino]acetamide |
| SMILES | CC(C)N(CCCCC(C)(C)CN)CC(N)=O |
| InChI | InChI=1S/C13H29N3O/c1-11(2)16(9-12(15)17)8-6-5-7-13(3,4)10-14/h11H,5-10,14H2,1-4H3,(H2,15,17) |
| InChIKey | FHLHXKUUSIVCKU-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|