C12H26N4O2 — CID 54988932
3-[(2-amino-2-oxoethyl)-propan-2-ylamino]-N-(3-aminopropyl)-N-methylpropanamide (PubChem CID 54988932) has the molecular formula C12H26N4O2 and a molecular weight of 258.37 g/mol. Its IUPAC name is 3-[(2-amino-2-oxoethyl)-propan-2-ylamino]-N-(3-aminopropyl)-N-methylpropanamide.
| Compound Name | 3-[(2-amino-2-oxoethyl)-propan-2-ylamino]-N-(3-aminopropyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 54988932 |
| Molecular Formula | C12H26N4O2 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 3-[(2-amino-2-oxoethyl)-propan-2-ylamino]-N-(3-aminopropyl)-N-methylpropanamide |
| SMILES | CC(C)N(CCC(=O)N(C)CCCN)CC(N)=O |
| InChI | InChI=1S/C12H26N4O2/c1-10(2)16(9-11(14)17)8-5-12(18)15(3)7-4-6-13/h10H,4-9,13H2,1-3H3,(H2,14,17) |
| InChIKey | PKSHJNQBMQTOHV-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |