C16H34N2O — CID 106708020
2-[(6-amino-5,5-dimethylhexyl)-cyclohexylamino]ethanol (PubChem CID 106708020) has the molecular formula C16H34N2O and a molecular weight of 270.46 g/mol. Its IUPAC name is 2-[(6-amino-5,5-dimethylhexyl)-cyclohexylamino]ethanol.
| Compound Name | 2-[(6-amino-5,5-dimethylhexyl)-cyclohexylamino]ethanol |
|---|---|
| PubChem CID | 106708020 |
| Molecular Formula | C16H34N2O |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.27 |
| IUPAC Name | 2-[(6-amino-5,5-dimethylhexyl)-cyclohexylamino]ethanol |
| SMILES | CC(C)(CN)CCCCN(CCO)C1CCCCC1 |
| InChI | InChI=1S/C16H34N2O/c1-16(2,14-17)10-6-7-11-18(12-13-19)15-8-4-3-5-9-15/h15,19H,3-14,17H2,1-2H3 |
| InChIKey | NMRDOULXQBRVRC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|