C15H28N4O — CID 106708468
2-(6-amino-5,5-dimethylhexyl)-5-[ethyl(methyl)amino]pyridazin-3-one (PubChem CID 106708468) has the molecular formula C15H28N4O and a molecular weight of 280.42 g/mol. Its IUPAC name is 2-(6-amino-5,5-dimethylhexyl)-5-[ethyl(methyl)amino]pyridazin-3-one.
| Compound Name | 2-(6-amino-5,5-dimethylhexyl)-5-[ethyl(methyl)amino]pyridazin-3-one |
|---|---|
| PubChem CID | 106708468 |
| Molecular Formula | C15H28N4O |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | 2-(6-amino-5,5-dimethylhexyl)-5-[ethyl(methyl)amino]pyridazin-3-one |
| SMILES | CCN(C)c1cnn(CCCCC(C)(C)CN)c(=O)c1 |
| InChI | InChI=1S/C15H28N4O/c1-5-18(4)13-10-14(20)19(17-11-13)9-7-6-8-15(2,3)12-16/h10-11H,5-9,12,16H2,1-4H3 |
| InChIKey | GFZFUJIJLRUYHH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|