C16H30N2 — CID 106709376
6-[(3-ethyl-2-methylcyclopentyl)amino]-2,2-dimethylhexanenitrile (PubChem CID 106709376) has the molecular formula C16H30N2 and a molecular weight of 250.43 g/mol. Its IUPAC name is 6-[(3-ethyl-2-methylcyclopentyl)amino]-2,2-dimethylhexanenitrile.
| Compound Name | 6-[(3-ethyl-2-methylcyclopentyl)amino]-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106709376 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | 6-[(3-ethyl-2-methylcyclopentyl)amino]-2,2-dimethylhexanenitrile |
| SMILES | CCC1CCC(NCCCCC(C)(C)C#N)C1C |
| InChI | InChI=1S/C16H30N2/c1-5-14-8-9-15(13(14)2)18-11-7-6-10-16(3,4)12-17/h13-15,18H,5-11H2,1-4H3 |
| InChIKey | AUWGGMRAECIJJZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|