C13H24N2O2S — CID 106709462
6-[(1,1-dioxothiolan-2-yl)methylamino]-2,2-dimethylhexanenitrile (PubChem CID 106709462) has the molecular formula C13H24N2O2S and a molecular weight of 272.41 g/mol. Its IUPAC name is 6-[(1,1-dioxothiolan-2-yl)methylamino]-2,2-dimethylhexanenitrile.
| Compound Name | 6-[(1,1-dioxothiolan-2-yl)methylamino]-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106709462 |
| Molecular Formula | C13H24N2O2S |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 6-[(1,1-dioxothiolan-2-yl)methylamino]-2,2-dimethylhexanenitrile |
| SMILES | CC(C)(C#N)CCCCNCC1CCCS1(=O)=O |
| InChI | InChI=1S/C13H24N2O2S/c1-13(2,11-14)7-3-4-8-15-10-12-6-5-9-18(12,16)17/h12,15H,3-10H2,1-2H3 |
| InChIKey | ARRYLPVWTOAEPC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|