C7H16N2O4S2 — CID 114385112
2-[(1,1-dioxothiolan-2-yl)methylamino]ethanesulfonamide (PubChem CID 114385112) has the molecular formula C7H16N2O4S2 and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-2-yl)methylamino]ethanesulfonamide.
| Compound Name | 2-[(1,1-dioxothiolan-2-yl)methylamino]ethanesulfonamide |
|---|---|
| PubChem CID | 114385112 |
| Molecular Formula | C7H16N2O4S2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 2-[(1,1-dioxothiolan-2-yl)methylamino]ethanesulfonamide |
| SMILES | NS(=O)(=O)CCNCC1CCCS1(=O)=O |
| InChI | InChI=1S/C7H16N2O4S2/c8-15(12,13)5-3-9-6-7-2-1-4-14(7,10)11/h7,9H,1-6H2,(H2,8,12,13) |
| InChIKey | NCRXSVFPYVTHBQ-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|