3-[(1,1-dioxothiolan-2-yl)methylsulfamoyl]propanoic acid

C8H15NO6S2 — CID 81039371

IUPAC3-[(1,1-dioxothiolan-2-yl)methylsulfamoyl]propanoic acid
SMILESO=C(O)CCS(=O)(=O)NCC1CCCS1(=O)=O
InChIInChI=1S/C8H15NO6S2/c10-8(11)3-5-17(14,15)9-6-7-2-1-4-16(7,12)13/h7,9H,1-6H2,(H,10,11)
InChIKeyYONLJBIXEAHPQV-UHFFFAOYSA-N
MW285.34 g/mol
LogP-1.04
Rot. Bonds6

About 3-[(1,1-dioxothiolan-2-yl)methylsulfamoyl]propanoic acid

3-[(1,1-dioxothiolan-2-yl)methylsulfamoyl]propanoic acid (PubChem CID 81039371) has the molecular formula C8H15NO6S2 and a molecular weight of 285.34 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-2-yl)methylsulfamoyl]propanoic acid.

Molecular Properties

Compound Name3-[(1,1-dioxothiolan-2-yl)methylsulfamoyl]propanoic acid
PubChem CID81039371
Molecular FormulaC8H15NO6S2
Molecular Weight285.34 g/mol
Exact Mass285.03
IUPAC Name3-[(1,1-dioxothiolan-2-yl)methylsulfamoyl]propanoic acid
SMILESO=C(O)CCS(=O)(=O)NCC1CCCS1(=O)=O
InChIInChI=1S/C8H15NO6S2/c10-8(11)3-5-17(14,15)9-6-7-2-1-4-16(7,12)13/h7,9H,1-6H2,(H,10,11)
InChIKeyYONLJBIXEAHPQV-UHFFFAOYSA-N
XLogP-1.04
TPSA117.61 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.34
LogP ≤ 5-1.04
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 3-[(1,1-dioxothiolan-2-yl)methylsulfamoyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(1,1-dioxothiolan-2-yl)methylsulfamoyl]propanoic acid?
The IUPAC name of 3-[(1,1-dioxothiolan-2-yl)methylsulfamoyl]propanoic acid (CID 81039371) is 3-[(1,1-dioxothiolan-2-yl)methylsulfamoyl]propanoic acid.
What is the SMILES notation for 3-[(1,1-dioxothiolan-2-yl)methylsulfamoyl]propanoic acid?
The canonical SMILES for 3-[(1,1-dioxothiolan-2-yl)methylsulfamoyl]propanoic acid is O=C(O)CCS(=O)(=O)NCC1CCCS1(=O)=O.
What is the InChIKey of 3-[(1,1-dioxothiolan-2-yl)methylsulfamoyl]propanoic acid?
The InChIKey is YONLJBIXEAHPQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO6S2/c10-8(11)3-5-17(14,15)9-6-7-2-1-4-16(7,12)13/h7,9H,1-6H2,(H,10,11).
What are the key properties of 3-[(1,1-dioxothiolan-2-yl)methylsulfamoyl]propanoic acid?
3-[(1,1-dioxothiolan-2-yl)methylsulfamoyl]propanoic acid has a molecular weight of 285.34 g/mol, XLogP of -1.04, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,1-dioxothiolan-2-yl)methylsulfamoyl]propanoic acid is sourced from PubChem (CID 81039371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).