C14H25N3 — CID 106709737
6-[2-cyanoethyl(propan-2-yl)amino]-2,2-dimethylhexanenitrile (PubChem CID 106709737) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is 6-[2-cyanoethyl(propan-2-yl)amino]-2,2-dimethylhexanenitrile.
| Compound Name | 6-[2-cyanoethyl(propan-2-yl)amino]-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106709737 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 6-[2-cyanoethyl(propan-2-yl)amino]-2,2-dimethylhexanenitrile |
| SMILES | CC(C)N(CCC#N)CCCCC(C)(C)C#N |
| InChI | InChI=1S/C14H25N3/c1-13(2)17(11-7-9-15)10-6-5-8-14(3,4)12-16/h13H,5-8,10-11H2,1-4H3 |
| InChIKey | BBBLZROUORCGEU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|