About 6-(4-iodopyrazol-1-yl)-2,2-dimethylhexanenitrile
6-(4-iodopyrazol-1-yl)-2,2-dimethylhexanenitrile (PubChem CID 106710266) has the molecular formula C11H16IN3
and a molecular weight of 317.17 g/mol. Its IUPAC name is 6-(4-iodopyrazol-1-yl)-2,2-dimethylhexanenitrile.
Molecular Properties
| Compound Name | 6-(4-iodopyrazol-1-yl)-2,2-dimethylhexanenitrile |
| PubChem CID | 106710266 |
| Molecular Formula | C11H16IN3 |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 6-(4-iodopyrazol-1-yl)-2,2-dimethylhexanenitrile |
| SMILES | CC(C)(C#N)CCCCn1cc(I)cn1 |
| InChI | InChI=1S/C11H16IN3/c1-11(2,9-13)5-3-4-6-15-8-10(12)7-14-15/h7-8H,3-6H2,1-2H3 |
| InChIKey | ALWNAFOVBVUYSQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-(4-iodopyrazol-1-yl)-2,2-dimethylhexanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-iodopyrazol-1-yl)-2,2-dimethylhexanenitrile?
The IUPAC name of 6-(4-iodopyrazol-1-yl)-2,2-dimethylhexanenitrile (CID 106710266) is 6-(4-iodopyrazol-1-yl)-2,2-dimethylhexanenitrile.
What is the SMILES notation for 6-(4-iodopyrazol-1-yl)-2,2-dimethylhexanenitrile?
The canonical SMILES for 6-(4-iodopyrazol-1-yl)-2,2-dimethylhexanenitrile is CC(C)(C#N)CCCCn1cc(I)cn1.
What is the InChIKey of 6-(4-iodopyrazol-1-yl)-2,2-dimethylhexanenitrile?
The InChIKey is ALWNAFOVBVUYSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16IN3/c1-11(2,9-13)5-3-4-6-15-8-10(12)7-14-15/h7-8H,3-6H2,1-2H3.
What are the key properties of 6-(4-iodopyrazol-1-yl)-2,2-dimethylhexanenitrile?
6-(4-iodopyrazol-1-yl)-2,2-dimethylhexanenitrile has a molecular weight of 317.17 g/mol, XLogP of 3.21, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-iodopyrazol-1-yl)-2,2-dimethylhexanenitrile is sourced from PubChem (CID 106710266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).