About 4-(4-iodopyrazol-1-yl)-2,2-dimethylbutanethioamide
4-(4-iodopyrazol-1-yl)-2,2-dimethylbutanethioamide (PubChem CID 65248714) has the molecular formula C9H14IN3S
and a molecular weight of 323.20 g/mol. Its IUPAC name is 4-(4-iodopyrazol-1-yl)-2,2-dimethylbutanethioamide.
Molecular Properties
| Compound Name | 4-(4-iodopyrazol-1-yl)-2,2-dimethylbutanethioamide |
| PubChem CID | 65248714 |
| Molecular Formula | C9H14IN3S |
| Molecular Weight | 323.20 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | 4-(4-iodopyrazol-1-yl)-2,2-dimethylbutanethioamide |
| SMILES | CC(C)(CCn1cc(I)cn1)C(N)=S |
| InChI | InChI=1S/C9H14IN3S/c1-9(2,8(11)14)3-4-13-6-7(10)5-12-13/h5-6H,3-4H2,1-2H3,(H2,11,14) |
| InChIKey | PFOLOCPDZFWGJJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-iodopyrazol-1-yl)-2,2-dimethylbutanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-iodopyrazol-1-yl)-2,2-dimethylbutanethioamide?
The IUPAC name of 4-(4-iodopyrazol-1-yl)-2,2-dimethylbutanethioamide (CID 65248714) is 4-(4-iodopyrazol-1-yl)-2,2-dimethylbutanethioamide.
What is the SMILES notation for 4-(4-iodopyrazol-1-yl)-2,2-dimethylbutanethioamide?
The canonical SMILES for 4-(4-iodopyrazol-1-yl)-2,2-dimethylbutanethioamide is CC(C)(CCn1cc(I)cn1)C(N)=S.
What is the InChIKey of 4-(4-iodopyrazol-1-yl)-2,2-dimethylbutanethioamide?
The InChIKey is PFOLOCPDZFWGJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14IN3S/c1-9(2,8(11)14)3-4-13-6-7(10)5-12-13/h5-6H,3-4H2,1-2H3,(H2,11,14).
What are the key properties of 4-(4-iodopyrazol-1-yl)-2,2-dimethylbutanethioamide?
4-(4-iodopyrazol-1-yl)-2,2-dimethylbutanethioamide has a molecular weight of 323.20 g/mol, XLogP of 2.19, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-iodopyrazol-1-yl)-2,2-dimethylbutanethioamide is sourced from PubChem (CID 65248714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).