C9H14IN3S — CID 65248714
4-(4-iodopyrazol-1-yl)-2,2-dimethylbutanethioamide (PubChem CID 65248714) has the molecular formula C9H14IN3S and a molecular weight of 323.20 g/mol. Its IUPAC name is 4-(4-iodopyrazol-1-yl)-2,2-dimethylbutanethioamide.
| Compound Name | 4-(4-iodopyrazol-1-yl)-2,2-dimethylbutanethioamide |
|---|---|
| PubChem CID | 65248714 |
| Molecular Formula | C9H14IN3S |
| Molecular Weight | 323.20 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | 4-(4-iodopyrazol-1-yl)-2,2-dimethylbutanethioamide |
| SMILES | CC(C)(CCn1cc(I)cn1)C(N)=S |
| InChI | InChI=1S/C9H14IN3S/c1-9(2,8(11)14)3-4-13-6-7(10)5-12-13/h5-6H,3-4H2,1-2H3,(H2,11,14) |
| InChIKey | PFOLOCPDZFWGJJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|